11-Keto-beta-boswellic acid Catalog No.:M14933-2 Smiles: CC(CC)C(NC(=O)C1CCCN1C(=O)CNC(=O)C1CCCN1C(=O)C(CC1C=CC=CC=1)NC(=O)C1CCCN1C(=O)C(N)CC1C=CC(O)=CC=1)C(O)=O

Smiles: CC(CC)C(NC(=O)C1CCCN1C(=O)CNC(=O)C1CCCN1C(=O)C(CC1C=CC=CC=1)NC(=O)C1CCCN1C(=O)C(N)CC1C=CC(O)=CC=1)C(O)=O

and Handles to the Lactam Bridge

117(3):1457-1467

CAS Number: 16616-39-0

ClH/c1-11-9-16(24)17(14-5-3-13(4-6-14)12(2)10-22)18-15-7-8-26-20(15)21(25)23-19(11)18

11-Keto-beta-boswellic acid Catalog No.:M14933-2 Smiles: CC(CC)C(NC(=O)C1CCCN1C(=O)CNC(=O)C1CCCN1C(=O)C(CC1C=CC=CC=1)NC(=O)C1CCCN1C(=O)C(N)CC1C=CC(O)=CC=1)C(O)=O11 Keto beta boswellic acid (11 Keto boswellic acid) is a pentacyclic triterpenic acid of the oleogum resin from the bark of the Boswellia serrate tree, popularly known as Indian Frankincense. 11 Keto beta boswellic acid has the anti inflammatory activity is primarily due to inhibit 5 lipoxygenase (5 LOX) and subsequent leukotriene and nuclear factor kappa B (NF B) activation and tumor necrosis factor alpha generation production. Product information